Molecular Definition

Canonical SMILES COc1cc2CCC(CCNC(=O)C)c2cc1OC
Formula C15H21NO3
Molecular Weight 263.33 da
Stereocenters 0/1