Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1F)C2=C(C=NN(CC3CCc4c(C3)cccc4OCC(=O)O)C2=O)c5ccccc5
Formula C30H27FN2O5
Molecular Weight 514.54 da
Stereocenters 0/1