Molecular Definition

Canonical SMILES Cc1cn(Cc2ccc(O)c(c2)c3ccccc3)c4ccc(OCC(=O)O)cc14
Formula C24H21NO4
Molecular Weight 387.43 da
Stereocenters 0/0