Molecular Definition

Canonical SMILES NC1=CNC(=O)c2cc(sc12)c3ccccc3
Formula C13H10N2OS
Molecular Weight 242.30 da
Stereocenters 0/0