Molecular Definition

Canonical SMILES CCCc1c(O)c(O)c(C(=O)O)c2cc(C)c(C)cc12
Formula C16H18O4
Molecular Weight 274.31 da
Stereocenters 0/0