Target Relevance

Molecular Definition

Canonical SMILES COC[C@@H]1CCCN1S(=O)(=O)c2cc(Br)c3N(C)C(=O)C(=O)c3c2
Formula C15H17BrN2O5S
Molecular Weight 417.28 da
Stereocenters 1/1