Molecular Definition

Canonical SMILES CN(C)CCNc1nccc(n1)c2cccnc2Oc3c(C)cc(Nc4nc5ccccc5[nH]4)c6ccccc36
Formula C31H30N8O
Molecular Weight 530.62 da
Stereocenters 0/0