Target Relevance

Renin Tclin
pIC50 134292 6.0

Molecular Definition

Canonical SMILES CC[C@H](C)CNC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)C(N)NC(=O)C(Cc1cccc2ccccc12)Cc3cccc4ccccc34
Formula C39H50N4O4
Molecular Weight 638.84 da
Stereocenters 3/4