Molecular Definition

Canonical SMILES Fc1ccc2cnn(N=C3NCCN3)c2c1
Formula C10H10FN5
Molecular Weight 219.22 da
Stereocenters 0/0