Target Relevance

Molecular Definition

Canonical SMILES CCc1c(Cc2ccccc2)n3cccc(OCCCC(=O)O)c3c1C(=O)C(=O)N
Formula C23H24N2O5
Molecular Weight 408.45 da
Stereocenters 0/0