Molecular Definition

Canonical SMILES Cl.C[C@@H](NS(=O)(=O)C)c1ccc(CNC[C@@H]2CO[C@H](CO2)c3ccccc3)cc1
Formula C21H29ClN2O4S
Molecular Weight 440.98 da
Stereocenters 3/3