Target Relevance

Molecular Definition

Canonical SMILES OC1=C(Sc2ccccc2C#N)C(=O)CC(C1)c3c(Br)cccc3Br
Formula C19H13Br2NO2S
Molecular Weight 479.19 da
Stereocenters 0/1