Molecular Definition

Canonical SMILES CN1C(=O)[C@]23CC4=CC=C[C@H](O)[C@H]4N2C(=O)[C@@]1(CO)SS3
Formula C13H14N2O4S2
Molecular Weight 326.39 da
Stereocenters 4/4