Molecular Definition

Canonical SMILES OC(=O)Cc1ccc(CNc2nc(nc(n2)c3cccc(Cl)c3)C4CC4)cc1
Formula C21H19ClN4O2
Molecular Weight 394.85 da
Stereocenters 0/0