Molecular Definition

Canonical SMILES Cc1ccc(cc1)[C@H]2CC(=NN2C(=O)c3occc3)c4cc(Cl)ccc4O
Formula C21H17ClN2O3
Molecular Weight 380.82 da
Stereocenters 1/1