Target Relevance

Molecular Definition

Canonical SMILES Oc1cccc(CN[C@H]2CCCC[C@H]2NC(=O)c3ccc(F)cc3)c1
Formula C20H23FN2O2
Molecular Weight 342.41 da
Stereocenters 2/2