Target Relevance

Molecular Definition

Canonical SMILES CNc1oc(nc1C#N)c2ccc(Cl)c(Cl)c2
Formula C11H7Cl2N3O
Molecular Weight 268.10 da
Stereocenters 0/0