Target Relevance

Molecular Definition

Canonical SMILES CC(C)C1=CC(=NNC1=O)Cc2c(Cl)cc(cc2Cl)N3N=CC(=O)NC3=O
Formula C17H15Cl2N5O3
Molecular Weight 408.24 da
Stereocenters 0/0