Target Relevance

Molecular Definition

Canonical SMILES Cc1cccc(n1)c2[nH]c(CNc3ccc(CC#N)cc3)nc2c4ccc5ncnn5c4
Formula C24H20N8
Molecular Weight 420.47 da
Stereocenters 0/0