Molecular Definition

Canonical SMILES CCCCC(Oc1ccc2C(=O)C(=COc2c1)c3ccc(O)cc3)C(=O)O
Formula C21H20O6
Molecular Weight 368.38 da
Stereocenters 0/1