Molecular Definition

Canonical SMILES COC(=O)c1ccc(cc1)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)C(=O)N[C@@H](C3CCCC3)C(=O)N[C@@H](CCCC[N+](C)(C)C)C(=O)NC(CO)CO
Formula C40H59N6O9
Molecular Weight 767.93 da
Stereocenters 4/5