Target Relevance

Molecular Definition

Canonical SMILES CN1CCN(CC1)c2ccccc2NC(=O)N3Sc4ccccc4C3=O
Formula C19H20N4O2S
Molecular Weight 368.45 da
Stereocenters 0/0