Molecular Definition

Canonical SMILES COc1c(O)cc2Oc3cc(O)c(CC=C(C)C)c(O)c3C(=O)c2c1CC=C(C)C
Formula C24H26O6
Molecular Weight 410.46 da
Stereocenters 0/0