Target Relevance

Molecular Definition

Canonical SMILES Nc1ccccc1NC(=O)CCCCCCC(=O)c2cccc(c2)c3ccccc3
Formula C26H28N2O2
Molecular Weight 400.51 da
Stereocenters 0/0