Target Relevance

Molecular Definition

Canonical SMILES CCCCCCN1N=CN(C1=O)c2ccc(cc2)S(=O)(=O)Nc3ccc(CCNC[C@H](O)c4cccnc4)cc3
Formula C29H36N6O4S
Molecular Weight 564.70 da
Stereocenters 1/1