Molecular Definition

Canonical SMILES Clc1ccc2N(CCc3ccccc3)C(=O)C(=O)c2c1
Formula C16H12ClNO2
Molecular Weight 285.73 da
Stereocenters 0/0