Molecular Definition

Canonical SMILES O=C(NCCCCS(=O)(=O)c1ccccc1)c2ccc3nccn3c2
Formula C18H19N3O3S
Molecular Weight 357.43 da
Stereocenters 0/0