Target Relevance

Molecular Definition

Canonical SMILES CCCCOc1cccc(CC(=O)N2CCNc3nc(ccc3C2)C(F)(F)F)c1
Formula C21H24F3N3O2
Molecular Weight 407.43 da
Stereocenters 0/0