Molecular Definition

Canonical SMILES CC(C)[C@@H](N)C(=O)N1CCC[C@H]1B(O)O
Formula C9H19BN2O3
Molecular Weight 214.07 da
Stereocenters 2/2