Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1cccc(c1)S(=O)(=O)N2C(=O)CN(C2=O)c3ccccc3
Formula C17H14N2O6S
Molecular Weight 374.37 da
Stereocenters 0/0