Molecular Definition

Canonical SMILES CCC[C@H]1C2CCC(C2)[C@H]1NC3=NCCO3
Formula C13H22N2O
Molecular Weight 222.33 da
Stereocenters 2/4