Molecular Definition

Canonical SMILES COc1ccccc1N2CCN(CCCc3ccc4nc(O)sc4c3)CC2
Formula C21H25N3O2S
Molecular Weight 383.51 da
Stereocenters 0/0