Molecular Definition

Canonical SMILES COCC1=C([C@@H](N(C(=O)N[C@H]2CC[C@H](C2)N3CCC(CC3)c4ccccc4C#N)C(=O)N1)c5ccc(F)c(F)c5)C(=O)OC
Formula C32H35F2N5O5
Molecular Weight 607.65 da
Stereocenters 3/3