Target Relevance

Molecular Definition

Canonical SMILES CC(=O)N1CCN(Cc2oc3ccc(cc3c2)C(=O)N4CCC(CC4)N5C(=O)OCc6ccccc56)CC1
Formula C29H32N4O5
Molecular Weight 516.59 da
Stereocenters 0/0