Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)C[C@H](S)C(=O)N[C@@H](Cc1ccc(cc1)c2ccccc2)C(=O)O
Formula C22H27NO3S
Molecular Weight 385.52 da
Stereocenters 2/2