Molecular Definition

Canonical SMILES OC(=O)CN1C(=O)C(=O)Nc2cc(c(cc12)n3cccc3)[N+](=O)[O-]
Formula C14H10N4O6
Molecular Weight 330.25 da
Stereocenters 0/0