Target Relevance

Molecular Definition

Canonical SMILES O[C@@H](CNCCc1ccc(NS(=O)(=O)c2ccccc2Cl)cc1)COc3ccc(O)cc3
Formula C23H25ClN2O5S
Molecular Weight 476.97 da
Stereocenters 1/1