Molecular Definition

Canonical SMILES COc1ccc(Cl)cc1[C@]2(F)C(=O)Nc3cc(ccc23)C(F)(F)F
Formula C16H10ClF4NO2
Molecular Weight 359.70 da
Stereocenters 1/1