Target Relevance

Molecular Definition

Canonical SMILES COc1cc(NS(=O)(=O)c2ccc(C)cc2N)c3ncccc3c1
Formula C17H17N3O3S
Molecular Weight 343.40 da
Stereocenters 0/0