Molecular Definition

Canonical SMILES Oc1ccc(CC(=O)Nc2n[nH]c3ccc(cc23)N4CCCS4(=O)=O)cc1
Formula C18H18N4O4S
Molecular Weight 386.43 da
Stereocenters 0/0