Molecular Definition

Canonical SMILES COc1ccc(OC(=O)N(CC(=O)O)Cc2ccc(OCCc3nc(oc3C)c4ccc(O)cc4)cc2)cc1
Formula C29H28N2O8
Molecular Weight 532.54 da
Stereocenters 0/0