Target Relevance

Molecular Definition

Canonical SMILES CCC(N1C=C(N=C(NCc2cc(OC)cc(OC)c2)C1=O)C(C)(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)CCCc3ccccc3
Formula C34H44N4O7
Molecular Weight 620.74 da
Stereocenters 1/2