Molecular Definition

Canonical SMILES [O-][N+](=O)c1ccc(CCN2CCN(CC2)C(=O)Cc3ccc(cc3)[N+](=O)[O-])cc1
Formula C20H22N4O5
Molecular Weight 398.41 da
Stereocenters 0/0