Molecular Definition

Canonical SMILES COc1cc2c(NC3CCN(CC3)C(C)C)nc(nc2cc1OCCCN4CCCC4)C5CCOCC5
Formula C29H45N5O3
Molecular Weight 511.70 da
Stereocenters 0/0