Molecular Definition

Canonical SMILES CNc1cc(ccn1)c2cc(NC(=O)[C@H](Cc3ccc(F)cc3)NCc4cncs4)n(C)n2
Formula C23H24FN7OS
Molecular Weight 465.55 da
Stereocenters 1/1