Molecular Definition

Canonical SMILES O=C(N1CCC(CC1)N2CCCC2)c3ccc(C(=O)N4CCC(CC4)N5CCCC5)c(NCc6ccccc6)c3
Formula C33H45N5O2
Molecular Weight 543.74 da
Stereocenters 0/0