Target Relevance

Molecular Definition

Canonical SMILES O=C1NC(=O)C2=Cc3ccc(cc3N(C2=N1)c4ccccc4)C#N
Formula C18H10N4O2
Molecular Weight 314.30 da
Stereocenters 0/0