Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)c1cc(C#N)c(nc1C)N2CC(C2)C(=O)NS(=O)(=O)c3ccc(Cl)s3
Formula C18H17ClN4O5S2
Molecular Weight 468.93 da
Stereocenters 0/0