Molecular Definition

Canonical SMILES CCOCc1c(cnn1c2ncc(C)c(n2)c3cccs3)C(=O)NCc4ccncc4
Formula C22H22N6O2S
Molecular Weight 434.51 da
Stereocenters 0/0