Molecular Definition

Canonical SMILES CCCCc1c(cnn1c2ncc(C)c(n2)c3cccs3)C(=O)NC4CCCc5ncn(C)c45
Formula C25H29N7OS
Molecular Weight 475.61 da
Stereocenters 0/1